CymitQuimica logo

CAS 887360-24-9

:

α-(5-Aminopentyl)-3-(trifluoromethyl)benzenemethanol

Description:
α-(5-Aminopentyl)-3-(trifluoromethyl)benzenemethanol, with the CAS number 887360-24-9, is a chemical compound characterized by its unique structural features. It contains a benzene ring substituted with a trifluoromethyl group and a benzylic alcohol moiety, along with a pentyl chain that includes an amino group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The amino group can participate in hydrogen bonding, potentially affecting solubility and reactivity. This compound may exhibit properties relevant to drug development, particularly in the context of designing molecules that interact with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be explored through various analytical methods, including NMR, mass spectrometry, and chromatography. Overall, the unique combination of functional groups in α-(5-Aminopentyl)-3-(trifluoromethyl)benzenemethanol suggests potential applications in pharmaceuticals or agrochemicals.
Formula:C13H18F3NO
InChI:InChI=1S/C13H18F3NO/c14-13(15,16)11-6-4-5-10(9-11)12(18)7-2-1-3-8-17/h4-6,9,12,18H,1-3,7-8,17H2
InChI key:InChIKey=QTPAKWYRDDFXGJ-UHFFFAOYSA-N
SMILES:C(CCCCCN)(O)C1=CC(C(F)(F)F)=CC=C1
Synonyms:
  • Benzenemethanol, α-(5-aminopentyl)-3-(trifluoromethyl)-
  • α-(5-Aminopentyl)-3-(trifluoromethyl)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.