CAS 887360-26-1
:N,N-Dimethyl-2-(2-piperidinyl)benzenemethanamine
Description:
N,N-Dimethyl-2-(2-piperidinyl)benzenemethanamine, identified by its CAS number 887360-26-1, is a chemical compound characterized by its structure, which includes a benzene ring substituted with a piperidine group and a dimethylamino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. Additionally, the dimethylamino group may enhance its lipophilicity, influencing its pharmacokinetic properties. Safety data regarding this compound would indicate potential hazards typical of amines, including irritation to skin and eyes, and it should be handled with appropriate safety precautions in a laboratory setting.
Formula:C14H22N2
InChI:InChI=1S/C14H22N2/c1-16(2)11-12-7-3-4-8-13(12)14-9-5-6-10-15-14/h3-4,7-8,14-15H,5-6,9-11H2,1-2H3
InChI key:InChIKey=CJBNGRDOGNMGFQ-UHFFFAOYSA-N
SMILES:C(N(C)C)C1=C(C=CC=C1)C2CCCCN2
Synonyms:- N,N-Dimethyl-2-(2-piperidinyl)benzenemethanamine
- Benzenemethanamine, N,N-dimethyl-2-(2-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.