CAS 887360-38-5

5-(2,4-Diethoxyphenyl)-1,3,4-thiadiazol-2-amine

Description:

5-(2,4-Diethoxyphenyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a diethoxyphenyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the thiadiazole moiety. The diethoxyphenyl group may enhance its solubility and reactivity, making it of interest in medicinal chemistry and material science. The presence of the amine functional group suggests potential for hydrogen bonding and reactivity in various chemical reactions. Additionally, compounds like this can be explored for their pharmacological properties, including antimicrobial or anti-inflammatory activities. Its specific applications and behavior in various environments would depend on further studies, including its stability, solubility in different solvents, and interaction with biological systems. Overall, 5-(2,4-Diethoxyphenyl)-1,3,4-thiadiazol-2-amine represents a class of compounds that may have significant implications in research and development within the fields of chemistry and pharmacology.

Formula: C₁₂H₁₅N₃O₂S

InChI: InChI=1S/C12H15N3O2S/c1-3-16-8-5-6-9(10(7-8)17-4-2)11-14-15-12(13)18-11/h5-7H,3-4H2,1-2H3,(H2,13,15)

InChI key: InChIKey=GBEGUKWTZHDMAL-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C=CC(OCC)=C1)C=2SC(N)=NN2

Synonyms:

• 5-(2,4-Diethoxyphenyl)-1,3,4-thiadiazol-2-amine
• 1,3,4-Thiadiazol-2-amine, 5-(2,4-diethoxyphenyl)-