CAS 887360-42-1

5-Bromo-8H-1,3-dioxolo[4,5-g]indole-7-carboxylic acid

Description:

5-Bromo-8H-1,3-dioxolo[4,5-g]indole-7-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes an indole moiety fused with a dioxole ring. The presence of a bromine atom at the 5-position contributes to its reactivity and potential applications in medicinal chemistry. This compound features a carboxylic acid functional group at the 7-position, which enhances its solubility in polar solvents and may facilitate interactions with biological targets. The dioxole ring system is known for its stability and can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with biological activity. Additionally, the compound's properties, such as melting point, solubility, and spectral characteristics, would be essential for understanding its behavior in different environments and its potential uses in research and industry.

Formula: C₁₀H₆BrNO₄

InChI: InChI=1S/C10H6BrNO4/c11-5-2-7-9(16-3-15-7)8-4(5)1-6(12-8)10(13)14/h1-2,12H,3H2,(H,13,14)

InChI key: InChIKey=VALNZNRTASOLCX-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C3=C(C1)OCO3)NC(C(O)=O)=C2

Synonyms:

• 8H-1,3-Dioxolo[4,5-g]indole-7-carboxylic acid, 5-bromo-
• 5-Bromo-8H-1,3-dioxolo[4,5-g]indole-7-carboxylic acid

5-Bromo-8H-[1,3]dioxolo[4,5-g]indole-7-carboxylic acid

CAS: 887360-42-1

Formula: C₁₀H₆BrNO₄

Molecular weight: 284.0629

Ref: IN-DA0045I0