CAS 887360-64-7

2-(1,1-Dimethylethyl)-8-methylimidazo[1,2-a]pyridine

Description:

2-(1,1-Dimethylethyl)-8-methylimidazo[1,2-a]pyridine, identified by its CAS number 887360-64-7, is a heterocyclic organic compound characterized by its imidazo[1,2-a]pyridine structure, which incorporates both nitrogen atoms and a fused aromatic system. This compound features a tert-butyl group (1,1-dimethylethyl) and a methyl group at specific positions on the imidazo ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of nitrogen atoms in the ring structure can influence its reactivity, making it potentially useful in various chemical reactions, including those involving nucleophilic substitutions or electrophilic additions. Additionally, compounds of this class may exhibit biological activity, which could be of interest in pharmaceutical research. However, specific toxicity and environmental impact data should be reviewed for safety assessments. Overall, this compound represents a complex structure with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₂H₁₆N₂

InChI: InChI=1S/C12H16N2/c1-9-6-5-7-14-8-10(12(2,3)4)13-11(9)14/h5-8H,1-4H3

InChI key: InChIKey=KIVKRJHRBAQCGI-UHFFFAOYSA-N

SMILES: CC=1C=2N(C=C(C(C)(C)C)N2)C=CC1

Synonyms:

• 2-(1,1-Dimethylethyl)-8-methylimidazo[1,2-a]pyridine
• Imidazo[1,2-a]pyridine, 2-(1,1-dimethylethyl)-8-methyl-
• 2-tert-Butyl-8-methylimidazo[1,2-a]pyridine
• 2-tert-Butyl-8-methyl-imidazo[1,2-a]pyridine