CAS 887361-14-0

2-(3,5-Dichlorophenyl)piperidine

Description:

2-(3,5-Dichlorophenyl)piperidine, identified by its CAS number 887361-14-0, is a chemical compound characterized by its piperidine ring structure substituted with a 3,5-dichlorophenyl group. This compound typically exhibits properties associated with both piperidine derivatives and chlorinated aromatic compounds. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the influence of the chlorinated phenyl group on its polarity. The presence of chlorine atoms can enhance the compound's biological activity and lipophilicity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the piperidine moiety contributes to its potential as a ligand in various chemical reactions or as a building block in synthetic pathways. Safety data should be consulted for handling and usage, as chlorinated compounds can pose environmental and health risks. Overall, 2-(3,5-Dichlorophenyl)piperidine represents a versatile structure with potential applications in drug discovery and chemical synthesis.

Formula: C₁₁H₁₃Cl₂N

InChI: InChI=1S/C11H13Cl2N/c12-9-5-8(6-10(13)7-9)11-3-1-2-4-14-11/h5-7,11,14H,1-4H2

InChI key: InChIKey=WHPIGIJJCAIISO-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=C(Cl)C1)C2CCCCN2

Synonyms:

• Piperidine, 2-(3,5-dichlorophenyl)-
• 2-(3,5-Dichlorophenyl)piperidine