CAS 887361-20-8

1-(2-Methoxyethyl)-2-(3-methylphenyl)-5-oxo-3-pyrrolidinecarboxylic acid

Description:

1-(2-Methoxyethyl)-2-(3-methylphenyl)-5-oxo-3-pyrrolidinecarboxylic acid, with the CAS number 887361-20-8, is a chemical compound characterized by its unique pyrrolidine structure, which includes a carboxylic acid functional group and a ketone. This compound features a methoxyethyl substituent and a 3-methylphenyl group, contributing to its potential biological activity and solubility properties. The presence of the pyrrolidine ring suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand for various biological targets. The methoxyethyl group can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Additionally, the compound's structural features may influence its reactivity and stability, making it a candidate for further research in medicinal chemistry. Overall, this compound's unique characteristics make it a subject of interest for studies related to drug development and synthetic chemistry.

Formula: C₁₅H₁₉NO₄

InChI: InChI=1S/C15H19NO4/c1-10-4-3-5-11(8-10)14-12(15(18)19)9-13(17)16(14)6-7-20-2/h3-5,8,12,14H,6-7,9H2,1-2H3,(H,18,19)

InChI key: InChIKey=OBQYFNIPAIEUEY-UHFFFAOYSA-N

SMILES: C(COC)N1C(C(C(O)=O)CC1=O)C2=CC(C)=CC=C2

Synonyms:

• 1-(2-Methoxyethyl)-2-(3-methylphenyl)-5-oxo-3-pyrrolidinecarboxylic acid
• 3-Pyrrolidinecarboxylic acid, 1-(2-methoxyethyl)-2-(3-methylphenyl)-5-oxo-