CymitQuimica logo

CAS 887361-21-9

:

2-(2,4-Dimethoxyphenyl)-1-ethyl-5-oxo-3-pyrrolidinecarboxylic acid

Description:
2-(2,4-Dimethoxyphenyl)-1-ethyl-5-oxo-3-pyrrolidinecarboxylic acid, with the CAS number 887361-21-9, is a chemical compound characterized by its unique pyrrolidine structure, which includes a carboxylic acid functional group and a ketone group. The presence of the 2,4-dimethoxyphenyl moiety contributes to its potential biological activity, as methoxy groups can influence the compound's solubility and reactivity. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic ring, which may affect its pharmacokinetic properties. Additionally, the ethyl group attached to the pyrrolidine ring may enhance its steric properties, potentially influencing its interaction with biological targets. The compound's structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, although specific biological activities and applications would require further investigation. Overall, its unique structural features make it a candidate for research in various chemical and biological fields.
Formula:C15H19NO5
InChI:InChI=1S/C15H19NO5/c1-4-16-13(17)8-11(15(18)19)14(16)10-6-5-9(20-2)7-12(10)21-3/h5-7,11,14H,4,8H2,1-3H3,(H,18,19)
InChI key:InChIKey=VXQYLXZYPLXLNR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(N(CC)C(=O)C1)C2=C(OC)C=C(OC)C=C2
Synonyms:
  • 2-(2,4-Dimethoxyphenyl)-1-ethyl-5-oxo-3-pyrrolidinecarboxylic acid
  • 3-Pyrrolidinecarboxylic acid, 2-(2,4-dimethoxyphenyl)-1-ethyl-5-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.