
CAS 88738-09-4
:(5-Hydroxy-1-cyclopenten-1-yl)phenylmethanone
Description:
(5-Hydroxy-1-cyclopenten-1-yl)phenylmethanone, with the CAS number 88738-09-4, is an organic compound characterized by its unique structural features, including a cyclopentene ring and a phenylmethanone moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the hydroxyl group contributes to its potential for hydrogen bonding, enhancing solubility in polar solvents and affecting its biological activity. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound's structure suggests potential applications in organic synthesis, pharmaceuticals, or as a building block in materials science. Its specific characteristics, such as melting point, boiling point, and spectral properties, would be determined through experimental methods and may vary based on purity and environmental conditions. Overall, (5-Hydroxy-1-cyclopenten-1-yl)phenylmethanone represents a versatile compound with interesting chemical behavior and potential utility in various fields.
Formula:C12H12O2
InChI:InChI=1S/C12H12O2/c13-11-8-4-7-10(11)12(14)9-5-2-1-3-6-9/h1-3,5-7,11,13H,4,8H2
InChI key:InChIKey=KAKVFSYQVNHFBS-UHFFFAOYSA-N
SMILES:C(=O)(C=1C(O)CCC1)C2=CC=CC=C2
Synonyms:- (5-Hydroxy-1-cyclopentenyl)(phenyl)methanone
- 2-Benzoylcyclopent-2-en-1-ol
- (5-Hydroxy-1-cyclopenten-1-yl)phenylmethanone
- (5-Hydroxy-cyclopent-1-enyl)-phenyl-methanone
- Methanone, (5-hydroxy-1-cyclopenten-1-yl)phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
