CymitQuimica logo

CAS 88740-79-8

:

4-(9H-Fluoren-9-ylidenemethyl)-N,N,3-trimethylbenzenamine

Description:
4-(9H-Fluoren-9-ylidenemethyl)-N,N,3-trimethylbenzenamine, with the CAS number 88740-79-8, is an organic compound characterized by its complex structure that includes a fluorenylidene moiety and a trimethyl-substituted aniline group. This compound typically exhibits properties associated with aromatic amines, such as a high degree of stability and potential for engaging in electrophilic substitution reactions due to the presence of the electron-rich aromatic systems. The fluorenylidene group contributes to its photophysical properties, making it potentially useful in applications such as organic light-emitting diodes (OLEDs) and other optoelectronic devices. Additionally, the presence of multiple methyl groups can influence its solubility and steric hindrance, affecting its reactivity and interaction with other chemical species. Overall, this compound is of interest in materials science and organic synthesis, particularly in the development of advanced functional materials.
Formula:C23H21N
InChI:InChI=1S/C23H21N/c1-16-14-18(24(2)3)13-12-17(16)15-23-21-10-6-4-8-19(21)20-9-5-7-11-22(20)23/h4-15H,1-3H3
InChI key:InChIKey=DBZCRYJMNKJHTI-UHFFFAOYSA-N
SMILES:C(=C1C=2C(C=3C1=CC=CC3)=CC=CC2)C4=C(C)C=C(N(C)C)C=C4
Synonyms:
  • Benzenamine, 4-(9H-fluoren-9-ylidenemethyl)-N,N,3-trimethyl-
  • 4-(9H-Fluoren-9-ylidenemethyl)-N,N,3-trimethylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.