CymitQuimica logo

CAS 887405-41-6

:

β-Amino-4-(dimethylamino)benzenepropanol

Description:
β-Amino-4-(dimethylamino)benzenepropanol, identified by its CAS number 887405-41-6, is an organic compound characterized by the presence of both amino and alcohol functional groups. This compound features a benzene ring substituted with a dimethylamino group and a propanol chain, which contributes to its unique chemical properties. The presence of the amino group suggests potential basicity, while the alcohol group indicates the ability to engage in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for various interactions, which can be explored in applications such as drug design or synthesis of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, β-Amino-4-(dimethylamino)benzenepropanol represents a versatile structure with potential utility in various chemical and biological contexts.
Formula:C11H18N2O
InChI:InChI=1S/C11H18N2O/c1-13(2)11-5-3-9(4-6-11)7-10(12)8-14/h3-6,10,14H,7-8,12H2,1-2H3
InChI key:InChIKey=ZTOHUVFPVDSUPB-UHFFFAOYSA-N
SMILES:C(C(CO)N)C1=CC=C(N(C)C)C=C1
Synonyms:
  • 2-Amino-3-[4-(dimethylamino)phenyl]propan-1-ol
  • Benzenepropanol, β-amino-4-(dimethylamino)-
  • β-Amino-4-(dimethylamino)benzenepropanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.