CymitQuimica logo

CAS 887405-42-7

:

β-Amino-2-thiophenepropanol

Description:
β-Amino-2-thiophenepropanol is an organic compound characterized by the presence of both an amino group and a thiophene ring within its structure. This compound typically exhibits properties associated with both amines and thiophenes, such as potential basicity due to the amino group and aromatic characteristics from the thiophene moiety. It is likely to be a solid at room temperature, with solubility in polar solvents due to the presence of the hydroxyl and amino functional groups. The compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it of interest in synthetic organic chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, where thiophene derivatives are often explored for their biological activities. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, β-Amino-2-thiophenepropanol represents a versatile structure with potential utility in various chemical applications.
Formula:C7H11NOS
InChI:InChI=1S/C7H11NOS/c8-6(5-9)4-7-2-1-3-10-7/h1-3,6,9H,4-5,8H2
InChI key:InChIKey=LKMKVVNGSUXRQB-UHFFFAOYSA-N
SMILES:C(C(CO)N)C1=CC=CS1
Synonyms:
  • β-Amino-2-thiophenepropanol
  • 2-Amino-3-(thiophen-2-yl)propan-1-ol
  • 2-Thiophenepropanol, β-amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.