CAS 887405-47-2
:1-[(5-Amino-2-methoxyphenyl)methyl]-2-pyrrolidinone
Description:
1-[(5-Amino-2-methoxyphenyl)methyl]-2-pyrrolidinone, identified by its CAS number 887405-47-2, is a chemical compound characterized by its unique structural features. It contains a pyrrolidinone ring, which contributes to its cyclic amide properties, and an amino-substituted aromatic moiety that enhances its potential for biological activity. The presence of the methoxy group on the aromatic ring may influence its solubility and reactivity, while the amino group can participate in hydrogen bonding and other interactions. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, which may include effects on neurotransmitter systems or other biological pathways. Its molecular structure suggests it could serve as a scaffold for the development of new therapeutic agents. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 1-[(5-Amino-2-methoxyphenyl)methyl]-2-pyrrolidinone represents a versatile structure with potential implications in drug design and development.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-16-11-5-4-10(13)7-9(11)8-14-6-2-3-12(14)15/h4-5,7H,2-3,6,8,13H2,1H3
InChI key:InChIKey=NRSSNPHXSVPMCK-UHFFFAOYSA-N
SMILES:C(C1=C(OC)C=CC(N)=C1)N2C(=O)CCC2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.