CAS 887405-54-1
:4-[5-(3,4-Dimethoxyphenyl)-2H-tetrazol-2-yl]piperidine
Description:
4-[5-(3,4-Dimethoxyphenyl)-2H-tetrazol-2-yl]piperidine, with the CAS number 887405-54-1, is a chemical compound that features a piperidine ring substituted with a tetrazole moiety and a dimethoxyphenyl group. This compound is characterized by its heterocyclic structure, which includes a five-membered tetrazole ring known for its stability and potential biological activity. The presence of the dimethoxyphenyl group enhances its lipophilicity and may contribute to its pharmacological properties. The compound is likely to exhibit various interactions due to the functional groups present, making it of interest in medicinal chemistry and drug development. Its unique structure may allow for specific binding interactions with biological targets, potentially leading to therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the piperidine and phenyl rings, which are critical factors in determining its behavior in biological systems and its utility in research.
Formula:C14H19N5O2
InChI:InChI=1S/C14H19N5O2/c1-20-12-4-3-10(9-13(12)21-2)14-16-18-19(17-14)11-5-7-15-8-6-11/h3-4,9,11,15H,5-8H2,1-2H3
InChI key:InChIKey=RCJOSCIHXIXEGO-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C2=NN(N=N2)C3CCNCC3)C=CC1OC
Synonyms:- 4-[5-(3,4-Dimethoxyphenyl)-2H-tetrazol-2-yl]piperidine
- Piperidine, 4-[5-(3,4-dimethoxyphenyl)-2H-tetrazol-2-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.