CAS 887405-62-1
:3-(aminomethyl)-7-fluoro-1H-quinolin-2-one
Description:
3-(Aminomethyl)-7-fluoro-1H-quinolin-2-one is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features an amino group (-NH2) attached to a methylene (-CH2-) group at the 3-position and a fluorine atom at the 7-position of the quinoline ring. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it a candidate for various biological activities. The fluorine atom can enhance lipophilicity and metabolic stability, which may influence the compound's pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as quinoline derivatives are known for their diverse biological activities, including antimicrobial and antitumor effects. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C10H9FN2O
InChI:InChI=1/C10H9FN2O/c11-8-2-1-6-3-7(5-12)10(14)13-9(6)4-8/h1-4H,5,12H2,(H,13,14)
SMILES:c1cc(cc2c1cc(CN)c(n2)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
