CymitQuimica logo

CAS 887406-79-3

:

O-methyl 2-{[(7-methoxy-2-oxo-2H-chromen-4-yl)acetyl]amino}ethanesulfonothioate

Description:
O-methyl 2-{[(7-methoxy-2-oxo-2H-chromen-4-yl)acetyl]amino}ethanesulfonothioate is a synthetic organic compound characterized by its complex structure, which includes a chromenone moiety, an acetyl group, and a sulfonothioate functional group. This compound features a methoxy group that enhances its solubility and potential biological activity. The presence of the sulfonothioate group suggests that it may exhibit unique reactivity, possibly participating in nucleophilic substitution reactions. The chromenone structure is known for its diverse biological activities, including antioxidant and anti-inflammatory properties. The compound's potential applications may extend to medicinal chemistry, where it could serve as a lead compound for drug development. Its specific interactions with biological targets would require further investigation through pharmacological studies. Overall, this compound exemplifies the intricate design often found in bioactive molecules, combining various functional groups that may contribute to its efficacy and specificity in biological systems.
Formula:C15H17NO6S2
InChI:InChI=1/C15H17NO6S2/c1-20-11-3-4-12-10(8-15(18)22-13(12)9-11)7-14(17)16-5-6-24(19,23)21-2/h3-4,8-9H,5-7H2,1-2H3,(H,16,17)
SMILES:COc1ccc2c(CC(=NCCS(=O)(=S)OC)O)cc(=O)oc2c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.