CAS 887406-79-3

O-methyl 2-{[(7-methoxy-2-oxo-2H-chromen-4-yl)acetyl]amino}ethanesulfonothioate

Description:

O-methyl 2-{[(7-methoxy-2-oxo-2H-chromen-4-yl)acetyl]amino}ethanesulfonothioate is a synthetic organic compound characterized by its complex structure, which includes a chromenone moiety, an acetyl group, and a sulfonothioate functional group. This compound features a methoxy group that enhances its solubility and potential biological activity. The presence of the sulfonothioate group suggests that it may exhibit unique reactivity, possibly participating in nucleophilic substitution reactions. The chromenone structure is known for its diverse biological activities, including antioxidant and anti-inflammatory properties. The compound's potential applications may extend to medicinal chemistry, where it could serve as a lead compound for drug development. Its specific interactions with biological targets would require further investigation through pharmacological studies. Overall, this compound exemplifies the intricate design often found in bioactive molecules, combining various functional groups that may contribute to its efficacy and specificity in biological systems.

Formula: C₁₅H₁₇NO₆S₂

InChI: InChI=1/C15H17NO6S2/c1-20-11-3-4-12-10(8-15(18)22-13(12)9-11)7-14(17)16-5-6-24(19,23)21-2/h3-4,8-9H,5-7H2,1-2H3,(H,16,17)

SMILES: COc1ccc2c(CC(=NCCS(=O)(=S)OC)O)cc(=O)oc2c1

N-[2-Methanethiosulfonylethyl]-7-methoxycoumarin-4-acetamide

CAS: 887406-79-3

Formula: C₁₅H₁₇NO₆S₂

Molecular weight: 371.4286

Ref: IN-DA004CSD