CAS 887406-85-1

1-[(4-methoxyphenyl)methyl]-5-(3-pyridyl)pyrrolidin-2-one

Description:

1-[(4-methoxyphenyl)methyl]-5-(3-pyridyl)pyrrolidin-2-one, identified by its CAS number 887406-85-1, is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidinone core substituted with both a methoxyphenyl and a pyridyl group. This compound typically exhibits properties associated with its functional groups, such as potential solubility in organic solvents and moderate polarity due to the presence of the methoxy and pyridyl moieties. The methoxy group can enhance lipophilicity, while the pyridyl ring may contribute to hydrogen bonding and interactions with biological targets. As a pyrrolidinone derivative, it may exhibit pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions, although specific biological activities would require empirical investigation. Safety and handling considerations should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₁₇H₁₈N₂O₂

InChI: InChI=1/C17H18N2O2/c1-21-15-6-4-13(5-7-15)12-19-16(8-9-17(19)20)14-3-2-10-18-11-14/h2-7,10-11,16H,8-9,12H2,1H3

SMILES: COc1ccc(cc1)CN1C(CCC1=O)c1cccnc1