CAS 887406-97-5
:Methyl 5-[[[2-(3,4-dimethoxyphenyl)ethyl]amino]carbonyl]-1,4-dihydro-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinecarboxylate
Description:
Methyl 5-[[[2-(3,4-dimethoxyphenyl)ethyl]amino]carbonyl]-1,4-dihydro-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinecarboxylate, identified by its CAS number 887406-97-5, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amines, esters, and aromatic rings. This compound features a pyridine ring, which contributes to its potential biological activity, and the presence of trifluoromethyl and methoxy groups, which can influence its lipophilicity and reactivity. The dihydropyridine moiety suggests that it may exhibit properties typical of calcium channel blockers or other pharmacological activities. Its structural complexity indicates potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The compound's solubility, stability, and reactivity would depend on the specific conditions, including pH and solvent, making it a subject of interest for further research in drug development and chemical synthesis.
Formula:C27H29F3N2O5
InChI:InChI=1S/C27H29F3N2O5/c1-15-22(25(33)31-13-12-17-10-11-20(35-3)21(14-17)36-4)24(23(16(2)32-15)26(34)37-5)18-8-6-7-9-19(18)27(28,29)30/h6-11,14,24,32H,12-13H2,1-5H3,(H,31,33)
InChI key:InChIKey=CKMPHETWUONTBH-UHFFFAOYSA-N
SMILES:C(NCCC1=CC(OC)=C(OC)C=C1)(=O)C=2C(C(C(OC)=O)=C(C)NC2C)C3=C(C(F)(F)F)C=CC=C3
Synonyms:- 3-Pyridinecarboxylic acid, 5-[[[2-(3,4-dimethoxyphenyl)ethyl]amino]carbonyl]-1,4-dihydro-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-, methyl ester
- Methyl 5-[[[2-(3,4-dimethoxyphenyl)ethyl]amino]carbonyl]-1,4-dihydro-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.