CymitQuimica logo

CAS 887407-07-0

:

Benzenepropanoic acid, 4,4′-dithiobis[α,α-dimethyl-, diethyl ester

Description:
Benzenepropanoic acid, 4,4′-dithiobis[α,α-dimethyl-, diethyl ester, identified by the CAS number 887407-07-0, is an organic compound characterized by its complex structure that includes a benzene ring, a propanoic acid moiety, and a dithiobis linkage. This compound features two ester groups derived from α,α-dimethylpropanoic acid, which contributes to its hydrophobic characteristics. The presence of the dithiobis group indicates that it may have applications in redox chemistry or as a potential cross-linking agent in polymer chemistry. Its molecular structure suggests that it may exhibit interesting chemical reactivity, particularly in reactions involving nucleophiles or electrophiles. Additionally, the compound's ester functionalities may impart certain solubility properties, making it relevant in various chemical applications, including synthesis and material science. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data for precise characterization.
Formula:C26H34O4S2
InChI:InChI=1S/C26H34O4S2/c1-7-29-23(27)25(3,4)17-19-9-13-21(14-10-19)31-32-22-15-11-20(12-16-22)18-26(5,6)24(28)30-8-2/h9-16H,7-8,17-18H2,1-6H3
InChI key:InChIKey=KMCIXBUBEZRPHL-UHFFFAOYSA-N
SMILES:C(C(C(OCC)=O)(C)C)C1=CC=C(SSC2=CC=C(CC(C(OCC)=O)(C)C)C=C2)C=C1
Synonyms:
  • Benzenepropanoic acid, 4,4′-dithiobis[α,α-dimethyl-, diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.