CAS 887407-17-2
:2-(5-fluoro-2,3-dihydro-1H-inden-1-yl)ethanol
Description:
2-(5-Fluoro-2,3-dihydro-1H-inden-1-yl)ethanol, identified by its CAS number 887407-17-2, is a chemical compound characterized by its unique structure that includes a fluorinated indene moiety and an ethanol functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the indene ring and the hydroxyl group. The fluorine atom can influence the compound's reactivity and polarity, potentially enhancing its biological activity or solubility in various solvents. As an alcohol, it can participate in hydrogen bonding, which may affect its physical properties such as boiling point and solubility in water. The presence of the indene structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, the characteristics of this compound suggest it could be relevant in various chemical and pharmaceutical applications, although specific data regarding its reactivity, stability, and biological activity would require further investigation.
Formula:C11H13FO
InChI:InChI=1/C11H13FO/c12-10-3-4-11-8(5-6-13)1-2-9(11)7-10/h3-4,7-8,13H,1-2,5-6H2
Synonyms:- 2-(5-Fluoro-indan-1-yl)-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
