CymitQuimica logo

CAS 887407-56-9

:

dimethyl 6,12-bis[2-(2-methoxy-2-oxoethoxy)-2-oxoethyl]-4,14-dioxo-3,9,15-trioxa-6,12-diazaheptadecane-1,17-dioate

Description:
Dimethyl 6,12-bis[2-(2-methoxy-2-oxoethoxy)-2-oxoethyl]-4,14-dioxo-3,9,15-trioxa-6,12-diazaheptadecane-1,17-dioate is a complex organic compound characterized by its multi-functional structure, which includes multiple ester and amide linkages. This compound features a long carbon chain with several oxygen and nitrogen atoms, indicating potential for hydrogen bonding and solubility in polar solvents. The presence of methoxy and keto groups suggests reactivity, particularly in nucleophilic substitution reactions. Its molecular structure implies potential applications in pharmaceuticals or materials science, particularly in drug delivery systems or as a polymer precursor. The compound's stability, solubility, and reactivity would depend on environmental conditions such as pH and temperature. Additionally, the presence of multiple functional groups may allow for diverse interactions with biological systems, making it a candidate for further research in medicinal chemistry. However, specific safety and handling information should be consulted from material safety data sheets (MSDS) or relevant literature due to the complexity of its structure.
Formula:C24H36N2O17
InChI:InChI=1/C24H36N2O17/c1-35-21(31)13-40-17(27)9-25(10-18(28)41-14-22(32)36-2)5-7-39-8-6-26(11-19(29)42-15-23(33)37-3)12-20(30)43-16-24(34)38-4/h5-16H2,1-4H3
SMILES:COC(=O)COC(=O)CN(CCOCCN(CC(=O)OCC(=O)OC)CC(=O)OCC(=O)OC)CC(=O)OCC(=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.