CAS 887408-15-3

5-(2-Methoxyphenyl)-4-isoxazolecarboxylic acid

Description:

5-(2-Methoxyphenyl)-4-isoxazolecarboxylic acid is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the 2-methoxyphenyl group enhances its potential for various interactions, making it of interest in medicinal chemistry and drug development. The isoxazole moiety is known for its biological activity, and derivatives of this structure often exhibit anti-inflammatory, analgesic, or antimicrobial properties. The compound's solubility, stability, and reactivity can be influenced by the substituents on the isoxazole and phenyl rings. Additionally, its molecular structure allows for potential hydrogen bonding and π-π stacking interactions, which can be significant in biological systems. Overall, 5-(2-Methoxyphenyl)-4-isoxazolecarboxylic acid represents a versatile scaffold for further chemical modifications and investigations into its pharmacological applications.

Formula: C₁₁H₉NO₄

InChI: InChI=1S/C11H9NO4/c1-15-9-5-3-2-4-7(9)10-8(11(13)14)6-12-16-10/h2-6H,1H3,(H,13,14)

InChI key: InChIKey=ZNHBVBDXZHGKMW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(ON=C1)C2=C(OC)C=CC=C2

Synonyms:

• 4-Isoxazolecarboxylic acid, 5-(2-methoxyphenyl)-
• 5-(2-Methoxyphenyl)-4-isoxazolecarboxylic acid

5-(2-Methoxyphenyl)-1,2-oxazole-4-carboxylic acid

CAS: 887408-15-3

Versatile small molecule scaffold

Formula: C₁₁H₉NO₄

Purity: Min. 95%

Molecular weight: 219.19 g/mol

Ref: 3D-MKB40815