CAS 887408-72-2
:1-ethyl-5-methyl-1H-pyrazole-4-carboxylic acid
Description:
1-Ethyl-5-methyl-1H-pyrazole-4-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group and a methyl group attached to the pyrazole ring, contributing to its unique properties. The carboxylic acid functional group (-COOH) at the 4-position enhances its acidity and solubility in polar solvents, making it useful in various chemical applications. The presence of both alkyl substituents and the carboxylic acid group can influence its reactivity, stability, and potential interactions with biological systems. This compound may be of interest in pharmaceutical research, agrochemicals, or as a building block in organic synthesis due to its structural characteristics. Additionally, its molecular interactions can be studied for potential applications in medicinal chemistry or materials science. Overall, 1-ethyl-5-methyl-1H-pyrazole-4-carboxylic acid exemplifies the diverse chemistry associated with pyrazole derivatives.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c1-3-9-5(2)6(4-8-9)7(10)11/h4H,3H2,1-2H3,(H,10,11)
SMILES:CCn1c(C)c(cn1)C(=O)O
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 1-ethyl-5-methyl-
- 1-Ethyl-5-methyl-1H-pyrazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
