CymitQuimica logo

CAS 88741-67-7

:

6-hydroxy-5,10-dimethoxy-7H-dibenzo[de,h]quinolin-7-one

Description:
6-Hydroxy-5,10-dimethoxy-7H-dibenzo[de,h]quinolin-7-one, with CAS number 88741-67-7, is a chemical compound that belongs to the class of dibenzoquinolines. This substance features a complex polycyclic structure characterized by two fused benzene rings and a quinoline moiety. The presence of hydroxyl (-OH) and methoxy (-OCH3) functional groups contributes to its chemical reactivity and solubility properties. Typically, compounds of this nature exhibit interesting biological activities, which may include antimicrobial, anti-inflammatory, or anticancer properties, although specific biological data for this compound may vary. Its molecular structure allows for potential interactions with various biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the positioning of the functional groups, which may affect its applications in research and industry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C18H13NO4
InChI:InChI=1/C18H13NO4/c1-22-10-3-4-11-12(8-10)16-14-9(5-6-19-16)7-13(23-2)18(21)15(14)17(11)20/h3-8,21H,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.