CAS 887411-44-1
:N-Hydroxy-α-methyl-3-pyridinemethanamine
Description:
N-Hydroxy-α-methyl-3-pyridinemethanamine, identified by its CAS number 887411-44-1, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by the presence of a hydroxyl group (-OH) attached to the nitrogen atom, which contributes to its reactivity and potential biological activity. The α-methyl group indicates that there is a methyl substituent on the carbon adjacent to the nitrogen in the side chain, influencing the compound's steric and electronic properties. N-Hydroxy derivatives often exhibit interesting pharmacological activities, including potential roles in medicinal chemistry as enzyme inhibitors or in the modulation of biological pathways. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the presence of functional groups, making it a subject of interest in both synthetic and medicinal chemistry. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c1-6(9-10)7-3-2-4-8-5-7/h2-6,9-10H,1H3
InChI key:InChIKey=SBYDBORWSVDNMI-UHFFFAOYSA-N
SMILES:C(NO)(C)C=1C=CC=NC1
Synonyms:- 3-[1-(Hydroxyamino)ethyl]pyridin
- 3-pyridinemethanamine, N-hydroxy-α-methyl-
- N-Hydroxy-1-(3-pyridinyl)ethanamine
- N-Hydroxy-1-(pyridin-3-yl)ethanamine
- N-Hydroxy-α-methyl-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-[1-(Pyridin-3-yl)ethyl]hydroxylamine
CAS:Controlled ProductApplications N-[1-(pyridin-3-yl)ethyl]hydroxylamine (cas# 887411-44-1) is a useful research chemical.
Formula:C7H10N2OColor and Shape:NeatMolecular weight:138.167

