CAS 887411-54-3
:N-1H-benzimidazol-4-yl-4-methoxybenzamide
Description:
N-1H-benzimidazol-4-yl-4-methoxybenzamide is a chemical compound characterized by its unique structural features, which include a benzimidazole moiety and a methoxy-substituted benzamide group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the benzimidazole ring suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The methoxy group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics and bioavailability. Additionally, the compound may exhibit various functional properties, including anti-inflammatory or anticancer activities, depending on its specific interactions within biological systems. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with altered properties. As with many compounds in medicinal chemistry, understanding its stability, reactivity, and interaction with biological systems is crucial for evaluating its potential applications in drug development.
Formula:C15H13N3O2
InChI:InChI=1/C15H13N3O2/c1-20-11-7-5-10(6-8-11)15(19)18-13-4-2-3-12-14(13)17-9-16-12/h2-9H,1H3,(H,16,17)(H,18,19)
Synonyms:- N-(3H-Benzoimidazol-4-yl)-4-methoxy-benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
