CAS 887411-61-2

ethyl 3-(1H-indazol-5-yl)-3-oxopropanoate

Description:

Ethyl 3-(1H-indazol-5-yl)-3-oxopropanoate, identified by its CAS number 887411-61-2, is a chemical compound characterized by its unique structure, which includes an indazole moiety and an ester functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its bioactive properties. The presence of the indazole ring contributes to its biological activity, making it a subject of interest in drug discovery. Ethyl 3-(1H-indazol-5-yl)-3-oxopropanoate may exhibit various chemical properties, such as solubility in organic solvents and stability under standard laboratory conditions. Its reactivity can be influenced by the functional groups present, allowing for potential modifications that could enhance its pharmacological profile. As with many organic compounds, safety data should be consulted to ensure proper handling and usage in laboratory settings.

Formula: C₁₂H₁₂N₂O₃

InChI: InChI=1/C12H12N2O3/c1-2-17-12(16)6-11(15)8-3-4-10-9(5-8)7-13-14-10/h3-5,7H,2,6H2,1H3,(H,13,14)

SMILES: CCOC(=O)CC(=O)c1ccc2c(c1)c[nH]n2

Ethyl 3-(1H-indazol-5-yl)-3-oxopropanoate

CAS: 887411-61-2

Ethyl 3-(1H-indazol-5-yl)-3-oxopropanoate

Purity: ≥95%

Molecular weight: 232.24g/mol

Ref: 54-OR30738