CymitQuimica logo

CAS 887411-97-4

:

4-[4-(1-methylethoxy)phenoxy]benzoic acid

Description:
4-[4-(1-Methylethoxy)phenoxy]benzoic acid, with the CAS number 887411-97-4, is an organic compound characterized by its complex molecular structure, which includes a benzoic acid moiety and an ether functional group. This compound features a phenoxy group substituted with a 1-methylethoxy group, contributing to its hydrophobic characteristics. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic nature. The presence of the carboxylic acid group (-COOH) allows for potential hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the purity and specific conditions under which it is studied. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C16H16O4
InChI:InChI=1/C16H16O4/c1-11(2)19-13-7-9-15(10-8-13)20-14-5-3-12(4-6-14)16(17)18/h3-11H,1-2H3,(H,17,18)
Synonyms:
  • 4-(4-Isopropoxy-phenoxy)-benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.