CAS 887412-01-3

4-[4-(2-methoxyethoxy)phenoxy]benzoic acid

Description:

4-[4-(2-Methoxyethoxy)phenoxy]benzoic acid, identified by its CAS number 887412-01-3, is an organic compound characterized by its complex molecular structure, which includes a benzoic acid moiety and an ether functional group. This compound features a phenoxy group substituted with a 2-methoxyethoxy chain, contributing to its solubility and potential applications in various fields, including pharmaceuticals and materials science. The presence of the carboxylic acid group (-COOH) indicates that it can participate in acid-base reactions, while the ether group enhances its hydrophilicity. The compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its molecular interactions could be influenced by the steric and electronic effects of the substituents, which may affect its reactivity and stability. Overall, 4-[4-(2-methoxyethoxy)phenoxy]benzoic acid represents a versatile structure with potential utility in diverse chemical applications.

Formula: C₁₆H₁₆O₅

InChI: InChI=1/C16H16O5/c1-19-10-11-20-13-6-8-15(9-7-13)21-14-4-2-12(3-5-14)16(17)18/h2-9H,10-11H2,1H3,(H,17,18)

Synonyms:

• 4-[4-(2-Methoxy-ethoxy)-phenoxy]-benzoic acid

Benzoic acid,4-[4-(2-methoxyethoxy)phenoxy]-

CAS: 887412-01-3

Formula: C₁₆H₁₆O₅

Molecular weight: 288.2952

Ref: IN-DA004F8V