CAS 887412-09-1

4-(difluoromethyl)-2-nitroaniline

Description:

4-(Difluoromethyl)-2-nitroaniline, with the CAS number 887412-09-1, is an organic compound characterized by the presence of both a nitro group and an aniline structure. This compound features a difluoromethyl group, which contributes to its unique chemical properties. Typically, it appears as a solid at room temperature and is soluble in organic solvents, though its solubility in water may be limited due to its hydrophobic characteristics. The nitro group introduces significant polarity, influencing its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The presence of fluorine atoms enhances its stability and may impart unique electronic properties, making it of interest in fields such as pharmaceuticals and agrochemicals. Additionally, the compound's structure suggests potential for use in dye synthesis or as an intermediate in the production of more complex molecules. Safety data should be consulted, as compounds with nitro and fluorinated groups can exhibit toxicity or environmental hazards.

Formula: C₇H₆F₂N₂O₂

InChI: InChI=1/C7H6F2N2O2/c8-7(9)4-1-2-5(10)6(3-4)11(12)13/h1-3,7H,10H2

SMILES: c1cc(c(cc1C(F)F)N(=O)=O)N

4-DIFLUOROMETHOXY-2-NITRO-ANILINE

CAS: 887412-09-1

Formula: C₇H₆F₂N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.1315

Ref: IN-DA00GTHC

4-(Difluoromethyl)-2-nitroaniline

CAS: 887412-09-1

4-(Difluoromethyl)-2-nitroaniline

Purity: 95%

Molecular weight: 188.13g/mol

Ref: 54-PC1002262

4-(Difluoromethyl)-2-nitroaniline

CAS: 887412-09-1

Purity: 98%

Molecular weight: 188.1340027

Ref: 10-F779831

4-(Difluoromethyl)-2-nitroaniline

CAS: 887412-09-1

Please enquire for more information about 4-(Difluoromethyl)-2-nitroaniline including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₇H₆F₂N₂O₂

Purity: Min. 95%

Molecular weight: 188.13 g/mol

Ref: 3D-FD81351