CymitQuimica logo

CAS 88742-91-0

:

4-(5-Amino-1,3,4-thiadiazol-2-yl)-2,6-dimethoxyphenol

Description:
4-(5-Amino-1,3,4-thiadiazol-2-yl)-2,6-dimethoxyphenol is a chemical compound characterized by its unique structural features, which include a phenolic moiety substituted with two methoxy groups and a thiadiazole ring containing an amino group. This compound typically exhibits properties associated with both phenolic compounds and heterocycles, such as potential antioxidant activity and biological activity due to the presence of the thiadiazole and amino functionalities. The methoxy groups can influence its solubility and reactivity, making it potentially useful in various chemical and pharmaceutical applications. The presence of the thiadiazole ring may also impart specific biological activities, including antimicrobial or anti-inflammatory properties. As with many organic compounds, its behavior in different environments, such as solubility in various solvents and stability under different conditions, can vary significantly. Overall, this compound's unique structure suggests potential utility in medicinal chemistry and materials science, warranting further investigation into its properties and applications.
Formula:C10H11N3O3S
InChI:InChI=1S/C10H11N3O3S/c1-15-6-3-5(4-7(16-2)8(6)14)9-12-13-10(11)17-9/h3-4,14H,1-2H3,(H2,11,13)
InChI key:InChIKey=QNBTUTTWKYBCPU-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=C(OC)C1O)C=2SC(N)=NN2
Synonyms:
  • 4-(5-Amino-1,3,4-thiadiazol-2-yl)-2,6-dimethoxyphenol
  • Phenol, 4-(5-amino-1,3,4-thiadiazol-2-yl)-2,6-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.