CAS 88742-94-3
:5-(1-Phenylethyl)-1,3,4-thiadiazol-2-amine
Description:
5-(1-Phenylethyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an amine functional group. This compound features a phenylethyl substituent, contributing to its potential biological activity and interaction with various biological targets. Thiadiazoles are known for their diverse pharmacological properties, including antimicrobial, anti-inflammatory, and anticancer activities. The presence of the amine group may enhance solubility and reactivity, making it a candidate for further chemical modifications or applications in medicinal chemistry. Additionally, the compound's molecular structure suggests potential for interactions with receptors or enzymes, which could be explored in drug development. Its CAS number, 88742-94-3, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, this compound represents a significant interest in the field of organic chemistry and pharmacology due to its potential therapeutic implications.
Formula:C10H11N3S
InChI:InChI=1S/C10H11N3S/c1-7(8-5-3-2-4-6-8)9-12-13-10(11)14-9/h2-7H,1H3,(H2,11,13)
InChI key:InChIKey=KFYSQDMAJLTMTR-UHFFFAOYSA-N
SMILES:C(C)(C=1SC(N)=NN1)C2=CC=CC=C2
Synonyms:- 1,3,4-Thiadiazol-2-amine, 5-(1-phenylethyl)-
- 5-(1-Phenylethyl)-1,3,4-thiadiazol-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
