CAS 88742-95-4

5-[2-(3,4,5-Trimethoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine

Description:

5-[2-(3,4,5-Trimethoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a substituted phenyl group. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound features a phenyl group that is further substituted with three methoxy groups, enhancing its lipophilicity and potentially influencing its interaction with biological targets. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. Its molecular structure suggests that it could participate in hydrogen bonding and other interactions due to the presence of the amine group. As with many organic compounds, its solubility, stability, and reactivity would be influenced by environmental factors such as pH and temperature. Overall, 5-[2-(3,4,5-Trimethoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine represents a class of compounds that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₃H₁₇N₃O₃S

InChI: InChI=1S/C13H17N3O3S/c1-17-9-6-8(7-10(18-2)12(9)19-3)4-5-11-15-16-13(14)20-11/h6-7H,4-5H2,1-3H3,(H2,14,16)

InChI key: InChIKey=KRZPGPCLXNPRMT-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C(OC)=CC(CCC2=NN=C(N)S2)=C1

Synonyms:

• 1,3,4-Thiadiazol-2-amine, 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-
• 5-[2-(3,4,5-Trimethoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine

1,3,4-Thiadiazol-2-amine, 5-[2-(3,4,5-trimethoxyphenyl)ethyl]-

CAS: 88742-95-4

Formula: C₁₃H₁₇N₃O₃S

Molecular weight: 295.3574

Ref: IN-DA004E16