CymitQuimica logo

CAS 88742-97-6

:

5-[2-(2-Pyridinyl)ethyl]-1,3,4-thiadiazol-2-amine

Description:
5-[2-(2-Pyridinyl)ethyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a pyridine moiety. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound features an amine functional group, which can participate in hydrogen bonding and influence its solubility and reactivity. The pyridine ring, known for its aromaticity, can enhance the compound's interaction with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. Additionally, its molecular structure suggests potential applications in drug development and synthesis of novel therapeutic agents. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C9H10N4S
InChI:InChI=1S/C9H10N4S/c10-9-13-12-8(14-9)5-4-7-3-1-2-6-11-7/h1-3,6H,4-5H2,(H2,10,13)
InChI key:InChIKey=VDLMTPDIAJBNGC-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=N1)C2=NN=C(N)S2
Synonyms:
  • 5-[2-(2-Pyridinyl)ethyl]-1,3,4-thiadiazol-2-amine
  • 1,3,4-Thiadiazol-2-amine, 5-[2-(2-pyridinyl)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.