CymitQuimica logo

CAS 88743-04-8

:

5-[[(4-Fluorophenyl)thio]methyl]-1,3,4-thiadiazol-2-amine

Description:
5-[[(4-Fluorophenyl)thio]methyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a fluorophenyl group. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound features a thioether linkage, which can influence its reactivity and solubility. The fluorine atom on the phenyl ring may enhance lipophilicity and affect the compound's interaction with biological targets. This compound is typically synthesized through specific organic reactions involving thiadiazole derivatives and fluorinated phenyl groups. Its applications may span across medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical interactions. As with many such compounds, understanding its stability, reactivity, and potential toxicity is crucial for its application in research and industry.
Formula:C9H8FN3S2
InChI:InChI=1S/C9H8FN3S2/c10-6-1-3-7(4-2-6)14-5-8-12-13-9(11)15-8/h1-4H,5H2,(H2,11,13)
InChI key:InChIKey=RKJPNJKNOVCCEW-UHFFFAOYSA-N
SMILES:C(SC1=CC=C(F)C=C1)C2=NN=C(N)S2
Synonyms:
  • 5-[[(4-Fluorophenyl)thio]methyl]-1,3,4-thiadiazol-2-amine
  • 1,3,4-Thiadiazol-2-amine, 5-[[(4-fluorophenyl)thio]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.