CAS 887430-98-0: 4-[(5-bromopyrimidin-2-yl)oxy]benzonitrile

Description:4-[(5-Bromopyrimidin-2-yl)oxy]benzonitrile is a chemical compound characterized by its unique structure, which includes a benzonitrile moiety and a pyrimidine ring substituted with a bromine atom. The presence of the bromine atom enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound features both aromatic and heterocyclic components, contributing to its stability and solubility properties. The nitrile functional group (-C≡N) is known for its ability to participate in various chemical reactions, making this compound versatile in synthetic applications. Additionally, the ether linkage between the pyrimidine and the benzonitrile enhances its electronic properties, which can influence its biological activity. Overall, 4-[(5-bromopyrimidin-2-yl)oxy]benzonitrile is of interest in research due to its potential as a building block in drug discovery and development, particularly in targeting specific biological pathways.

Formula:C₁₁H₆BrN₃O

InChI:InChI=1/C11H6BrN3O/c12-9-6-14-11(15-7-9)16-10-3-1-8(5-13)2-4-10/h1-4,6-7H

Synonyms:
Benzonitrile, 4-[(5-bromo-2-pyrimidinyl)oxy]-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-[(5-BROMOPYRIMIDIN-2-YL)OXY]BENZONITRILE REF: IN-DA008BR6CAS: 887430-98-0	- - -	To inquire	Tue 06 May 25
4-[(5-Bromopyrimidin-2-yl)oxy]benzonitrile REF: 54-OR33460CAS: 887430-98-0	95%	482.00 €~3,298.00 €	Mon 05 May 25
4-(5-Bromo-pyrimidin-2-yloxy)-benzonitrile REF: 10-F036452CAS: 887430-98-0	97.0%	To inquire	Wed 14 May 25
4-[(5-Bromopyrimidin-2-yl)oxy]benzonitrile REF: 3D-MKB43098CAS: 887430-98-0	Min. 95%	- - -	Discontinued product