CymitQuimica logo

CAS 887433-64-9

:

N'-(5-bromopyrimidin-2-yl)-N,N-dimethylethane-1,2-diamine

Description:
N'-(5-bromopyrimidin-2-yl)-N,N-dimethylethane-1,2-diamine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a bromine atom at the 5-position and an ethylene diamine moiety. This compound features two dimethylamino groups attached to the nitrogen atoms of the ethylene diamine, enhancing its basicity and potential reactivity. The presence of the bromine atom contributes to its electrophilic properties, making it useful in various synthetic applications, particularly in medicinal chemistry and drug development. The compound is likely to exhibit solubility in polar solvents due to the presence of amine groups, which can engage in hydrogen bonding. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further investigation in pharmacological studies. As with many brominated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C8H13BrN4
InChI:InChI=1/C8H13BrN4/c1-13(2)4-3-10-8-11-5-7(9)6-12-8/h5-6H,3-4H2,1-2H3,(H,10,11,12)
SMILES:CN(C)CCN=c1[nH]cc(cn1)Br
Synonyms:
  • 1,2-ethanediamine, N~2~-(5-bromo-2-pyrimidinyl)-N~1~,N~1~-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.