CAS 88746-58-1
:2-(bromomethyl)fluoranthene
Description:
2-(Bromomethyl)fluoranthene is an organic compound that belongs to the class of polycyclic aromatic hydrocarbons (PAHs). It features a fluoranthene backbone, which consists of four fused benzene rings, with a bromomethyl group (-CH2Br) attached to the second position. This substitution introduces both bromine and a reactive methylene group, which can participate in various chemical reactions, making it useful in synthetic organic chemistry. The presence of the bromine atom enhances the compound's reactivity, allowing for potential applications in the synthesis of more complex molecules. Additionally, due to its polycyclic structure, 2-(bromomethyl)fluoranthene may exhibit interesting photophysical properties, including fluorescence. However, like many PAHs, it may also pose environmental and health risks, as some PAHs are known to be carcinogenic. Proper handling and disposal are essential when working with this compound in laboratory settings. Overall, 2-(bromomethyl)fluoranthene is a significant compound for research in organic synthesis and materials science.
Formula:C17H11Br
InChI:InChI=1/C17H11Br/c18-10-11-8-12-4-3-7-15-13-5-1-2-6-14(13)16(9-11)17(12)15/h1-9H,10H2
Synonyms:- 2-BROMOMETHYLFLUORANTHENE
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
