CAS 887475-44-7
:1,1-Dimethylethyl N-5-isothiazolylcarbamate
Description:
1,1-Dimethylethyl N-5-isothiazolylcarbamate, also known by its CAS number 887475-44-7, is a chemical compound that belongs to the class of carbamates. It is characterized by the presence of a dimethyl group attached to a tert-butyl structure, which contributes to its stability and hydrophobic properties. The isothiazole moiety in its structure imparts biological activity, making it of interest in agricultural applications, particularly as a pesticide or fungicide. This compound typically exhibits low volatility and is soluble in organic solvents, which enhances its utility in formulations. Its mode of action often involves interference with specific biological pathways in target organisms, leading to effective pest control. Safety and environmental impact assessments are crucial for its use, as with any agrochemical, to ensure minimal adverse effects on non-target species and ecosystems. Overall, 1,1-Dimethylethyl N-5-isothiazolylcarbamate represents a significant compound in the realm of agricultural chemistry, combining efficacy with a unique chemical structure.
Formula:C8H12N2O2S
InChI:InChI=1S/C8H12N2O2S/c1-8(2,3)12-7(11)10-6-4-5-9-13-6/h4-5H,1-3H3,(H,10,11)
InChI key:InChIKey=SQAJSDVESDXUAV-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=CC=NS1
Synonyms:- Carbamic acid, 5-isothiazolyl-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-5-isothiazolylcarbamate
- Carbamic acid, N-5-isothiazolyl-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.