CAS 88750-74-7
:6-propyl-5H-indeno[5,6-d][1,3]dioxole
Description:
6-Propyl-5H-indeno[5,6-d][1,3]dioxole is an organic compound characterized by its unique bicyclic structure, which incorporates both an indene and a dioxole moiety. This compound features a propyl group attached to the indeno framework, influencing its physical and chemical properties. Typically, compounds of this nature exhibit moderate to low solubility in water due to their hydrophobic characteristics, while being more soluble in organic solvents. The presence of the dioxole ring contributes to potential reactivity, particularly in electrophilic substitution reactions. Additionally, the compound may exhibit interesting optical and electronic properties, making it of interest in materials science and organic electronics. Its structural complexity suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature review. Overall, 6-propyl-5H-indeno[5,6-d][1,3]dioxole represents a fascinating subject for research within the field of organic chemistry.
Formula:C13H14O2
InChI:InChI=1/C13H14O2/c1-2-3-9-4-10-6-12-13(15-8-14-12)7-11(10)5-9/h4,6-7H,2-3,5,8H2,1H3
Synonyms:- 5H-Indeno(5,6-d)-1,3-dioxole, 6-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
