CAS 887502-05-8
:Ethanol, 2-mercapto-, sulfite (2:1)
Description:
Ethanol, 2-mercapto-, sulfite (2:1), with the CAS number 887502-05-8, is a chemical compound that features both an ethanol moiety and a mercapto group, indicating the presence of a thiol functional group. This compound is characterized by its potential use in various applications, including as a reducing agent or in the synthesis of other chemical entities. The sulfite component suggests that it may have applications in preserving or stabilizing other substances, particularly in food or pharmaceutical contexts. The presence of the mercapto group also implies that it may exhibit antioxidant properties, which can be beneficial in preventing oxidative damage in biological systems. Ethanol serves as a solvent and can enhance the solubility of the compound in various media. Overall, this compound's unique structure combines the properties of alcohols and thiols, making it versatile in chemical reactions and applications. However, specific safety and handling guidelines should be followed due to the potential reactivity of thiol groups.
Formula:C4H10O3S3
InChI:InChI=1S/C4H10O3S3/c5-10(6-1-3-8)7-2-4-9/h8-9H,1-4H2
InChI key:InChIKey=GWVPOKUIHHTOHB-UHFFFAOYSA-N
SMILES:S(OCCS)(OCCS)=O
Synonyms:- Ethanol, 2-mercapto-, sulfite (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
