CAS 88751-11-5
:N-(4-Ethoxyphenyl)-N-hydroxyformamide
Description:
N-(4-Ethoxyphenyl)-N-hydroxyformamide, with the CAS number 88751-11-5, is an organic compound characterized by its functional groups, including a formamide moiety and a hydroxyl group attached to a phenyl ring. This compound typically exhibits properties associated with both amides and phenolic compounds, such as moderate solubility in polar solvents due to the presence of the hydroxyl group. The ethoxy group enhances its lipophilicity, potentially influencing its biological activity and interactions. It may participate in hydrogen bonding due to the hydroxyl group, which can affect its reactivity and stability. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where derivatives of formamides are often explored for their biological activities. Additionally, the presence of the ethoxy group may impart specific electronic effects, influencing the compound's reactivity in various chemical reactions. Overall, N-(4-Ethoxyphenyl)-N-hydroxyformamide is a compound of interest in organic chemistry, particularly in the context of synthesis and potential applications in medicinal chemistry.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-2-13-8-5-3-7(4-6-8)10-9(11)12/h3-6,10H,2H2,1H3,(H,11,12)
InChI key:InChIKey=IFNDNBXRZMKMPY-UHFFFAOYSA-N
SMILES:N(C=O)(O)C1=CC=C(OCC)C=C1
Synonyms:- N-Hydroxy-N-formyl-p-phenetidine
- N-(4-Ethoxyphenyl)-N-hydroxyformamide
- Formamide, N-(4-ethoxyphenyl)-N-hydroxy-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
