CymitQuimica logo

CAS 88753-48-4

:

3-{(Z)-[2,6-bis(propylsulfanyl)pyridin-3-yl]-NNO-azoxy}-2,6-bis(propylsulfanyl)pyridine

Description:
The chemical substance known as "3-{(Z)-[2,6-bis(propylsulfanyl)pyridin-3-yl]-NNO-azoxy}-2,6-bis(propylsulfanyl)pyridine," with the CAS number 88753-48-4, is a complex organic compound characterized by its azoxy functional group and multiple pyridine rings. The presence of propylsulfanyl substituents indicates that the compound has significant sulfur content, which may influence its reactivity and solubility. The azoxy group typically contributes to the compound's potential as a dye or pigment, as well as its electronic properties. The stereochemistry indicated by the (Z) configuration suggests specific spatial arrangements that can affect the compound's interactions and biological activity. Overall, this substance may exhibit interesting properties such as potential biological activity, solubility in organic solvents, and specific reactivity patterns due to its unique structural features. Further studies would be necessary to fully elucidate its chemical behavior and potential applications in fields such as materials science or medicinal chemistry.
Formula:C22H32N4OS4
InChI:InChI=1/C22H32N4OS4/c1-5-13-28-19-11-9-17(21(23-19)30-15-7-3)25-26(27)18-10-12-20(29-14-6-2)24-22(18)31-16-8-4/h9-12H,5-8,13-16H2,1-4H3/b26-25-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.