CAS 88755-23-1
:2,4-bis(1,3-benzodioxol-5-yl)-4-oxobutanenitrile
Description:
2,4-bis(1,3-benzodioxol-5-yl)-4-oxobutanenitrile, identified by its CAS number 88755-23-1, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups. This compound features two benzodioxole moieties, which contribute to its potential biological activity and stability. The presence of a nitrile group (-C≡N) and a ketone group (C=O) suggests that it may exhibit reactivity typical of these functional groups, such as nucleophilic addition or condensation reactions. The compound is likely to be soluble in organic solvents due to its hydrophobic aromatic components, while its polar nitrile and carbonyl groups may impart some degree of solubility in polar solvents. Its unique structure may make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific data regarding its physical properties, biological activity, and safety profile would require further investigation through experimental studies and literature review.
Formula:C18H13NO5
InChI:InChI=1/C18H13NO5/c19-8-13(11-1-3-15-17(6-11)23-9-21-15)5-14(20)12-2-4-16-18(7-12)24-10-22-16/h1-4,6-7,13H,5,9-10H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
