CAS 887567-78-4
:3-Bromo-4,6-difluoro-1H-indazole
Description:
3-Bromo-4,6-difluoro-1H-indazole is a synthetic organic compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of bromine and fluorine substituents at specific positions on the indazole ring significantly influences its chemical properties and reactivity. The bromine atom typically enhances the compound's electrophilicity, while the fluorine atoms can impart unique electronic characteristics due to their electronegativity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated indazoles can exhibit diverse biological activities. Additionally, its molecular structure may contribute to its solubility and stability in various solvents, making it a candidate for further research in drug design and synthesis. As with many halogenated compounds, safety precautions should be observed when handling, due to potential toxicity and environmental impact.
Formula:C7H3BrF2N2
InChI:InChI=1S/C7H3BrF2N2/c8-7-6-4(10)1-3(9)2-5(6)11-12-7/h1-2H,(H,11,12)
InChI key:InChIKey=OMGZJDWENSGDAU-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(F)=C1)NN=C2Br
Synonyms:- 1H-Indazole, 3-bromo-4,6-difluoro-
- 3-Bromo-4,6-difluoro-1H-indazole
- 3-Bromo-4,6-difluoro indazole
- 3-bromo-4,6-difluoro-2~{H}-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
