CAS 887567-80-8
:4,6-Difluoro-1H-indazole-3-carboxaldehyde
Description:
4,6-Difluoro-1H-indazole-3-carboxaldehyde is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of two fluorine atoms at the 4 and 6 positions of the indazole ring significantly influences its electronic properties and reactivity. The carboxaldehyde functional group at the 3-position introduces a reactive aldehyde moiety, making it useful in various synthetic applications, including as an intermediate in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with indazole derivatives. Additionally, the fluorine substituents can enhance lipophilicity and metabolic stability, which are desirable traits in drug design. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H4F2N2O
InChI:InChI=1S/C8H4F2N2O/c9-4-1-5(10)8-6(2-4)11-12-7(8)3-13/h1-3H,(H,11,12)
InChI key:InChIKey=TVWXGRIXOURZGK-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NN1)=CC(F)=CC2F
Synonyms:- 4,6-Difluoro-1H-indazole-3-carboxaldehyde
- 1H-Indazole-3-carboxaldehyde, 4,6-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
