CAS 887567-88-6

3-Chloro-6-fluoro-4-iodo-1H-indazole

Description:

3-Chloro-6-fluoro-4-iodo-1H-indazole is a heterocyclic compound characterized by the presence of an indazole ring, which consists of a fused benzene and pyrazole structure. This compound features three halogen substituents: chlorine, fluorine, and iodine, which can significantly influence its chemical reactivity and biological activity. The presence of these halogens often enhances the lipophilicity and can affect the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. The specific positions of the halogens on the indazole ring contribute to its unique electronic properties and steric effects, which can be crucial for interactions with biological targets. Additionally, compounds like this one may exhibit various biological activities, including potential use as pharmaceuticals or agrochemicals. Its synthesis typically involves multi-step reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. Overall, 3-Chloro-6-fluoro-4-iodo-1H-indazole represents a complex and potentially valuable chemical entity in research and development.

Formula: C₇H₃ClFIN₂

InChI: InChI=1S/C7H3ClFIN2/c8-7-6-4(10)1-3(9)2-5(6)11-12-7/h1-2H,(H,11,12)

InChI key: InChIKey=GQWGNDMWZGBNAR-UHFFFAOYSA-N

SMILES: IC1=C2C(=CC(F)=C1)NN=C2Cl

Synonyms:

• 3-Chloro-6-fluoro-4-iodo-1H-indazole
• 1H-Indazole, 3-chloro-6-fluoro-4-iodo-