CAS 887567-89-7
:6-Fluoro-4-iodo-1H-indazole
Description:
6-Fluoro-4-iodo-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 6-position and an iodine atom at the 4-position contributes to its unique reactivity and potential biological activity. This compound is typically classified as a halogenated indazole derivative, which may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly influencing pathways related to cancer or other diseases. The compound's solubility, stability, and reactivity can vary based on the substituents and the overall molecular environment. As with many halogenated compounds, it may also exhibit distinct physical properties, such as melting and boiling points, which are influenced by the presence of the halogen atoms. Overall, 6-Fluoro-4-iodo-1H-indazole represents a valuable compound for research in drug development and chemical synthesis.
Formula:C7H4FIN2
InChI:InChI=1S/C7H4FIN2/c8-4-1-6(9)5-3-10-11-7(5)2-4/h1-3H,(H,10,11)
InChI key:InChIKey=JNVXNXRFDLJOEJ-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC(F)=C1)NN=C2
Synonyms:- 6-Fluoro-4-iodo-1H-indazole
- 1H-Indazole, 6-fluoro-4-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
