CAS 887568-34-5

3,4-Dibromo-6-chloro-1H-indazole

Description:

3,4-Dibromo-6-chloro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of two bromine atoms at the 3 and 4 positions and a chlorine atom at the 6 position contributes to its unique chemical properties, including increased reactivity and potential for various substitution reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen substituents that can enhance biological activity. Additionally, the compound may exhibit interesting electronic properties owing to the halogen atoms, which can influence its interaction with biological targets. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 3,4-Dibromo-6-chloro-1H-indazole is a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₇H₃Br₂ClN₂

InChI: InChI=1S/C7H3Br2ClN2/c8-4-1-3(10)2-5-6(4)7(9)12-11-5/h1-2H,(H,11,12)

InChI key: InChIKey=DYFNPKWCYOIAOE-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CC(Cl)=C1)NN=C2Br

Synonyms:

• 3,4-Dibromo-6-chloro-1H-indazole
• 1H-Indazole, 3,4-dibromo-6-chloro-