
CAS 887568-35-6
:4-Bromo-6-chloro-3-iodo-1H-indazole
Description:
4-Bromo-6-chloro-3-iodo-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring containing nitrogen atoms. The presence of bromine, chlorine, and iodine substituents at specific positions on the indazole ring contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit varying solubility in organic solvents, depending on the nature of the substituents. It is of interest in medicinal chemistry and material science due to its potential biological activity and applications in drug development. The halogen substituents can influence the compound's electronic properties, stability, and interactions with biological targets. Additionally, the compound's structure may allow for various synthetic modifications, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed, as halogenated compounds can pose health risks and environmental concerns.
Formula:C7H3BrClIN2
InChI:InChI=1S/C7H3BrClIN2/c8-4-1-3(9)2-5-6(4)7(10)12-11-5/h1-2H,(H,11,12)
InChI key:InChIKey=YLGDCONPQXFGBH-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(Cl)=C1)NN=C2I
Synonyms:- 1H-Indazole, 4-bromo-6-chloro-3-iodo-
- 4-Bromo-6-chloro-3-iodo-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.